3-Methylheptane
Encyclopedia
3-Methylheptane is a branched alkane
isomer
ic to octane
. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
Its refractive index
is 1.398 (20 °C, D).
Alkane
Alkanes are chemical compounds that consist only of hydrogen and carbon atoms and are bonded exclusively by single bonds without any cycles...
isomer
Isomer
In chemistry, isomers are compounds with the same molecular formula but different structural formulas. Isomers do not necessarily share similar properties, unless they also have the same functional groups. There are many different classes of isomers, like stereoisomers, enantiomers, geometrical...
ic to octane
Octane
Octane is a hydrocarbon and an alkane with the chemical formula C8H18, and the condensed structural formula CH36CH3. Octane has many structural isomers that differ by the amount and location of branching in the carbon chain...
. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
Its refractive index
Refractive index
In optics the refractive index or index of refraction of a substance or medium is a measure of the speed of light in that medium. It is expressed as a ratio of the speed of light in vacuum relative to that in the considered medium....
is 1.398 (20 °C, D).